C15H20N6O3 — CID 122318787
3-methoxy-1-methyl-N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]pyrazole-4-carboxamide (PubChem CID 122318787) has the molecular formula C15H20N6O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-methoxy-1-methyl-N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]pyrazole-4-carboxamide.
| Compound Name | 3-methoxy-1-methyl-N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 122318787 |
| Molecular Formula | C15H20N6O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 3-methoxy-1-methyl-N-[(4-morpholin-4-ylpyrimidin-2-yl)methyl]pyrazole-4-carboxamide |
| SMILES | COc1nn(C)cc1C(=O)NCc1nccc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H20N6O3/c1-20-10-11(15(19-20)23-2)14(22)17-9-12-16-4-3-13(18-12)21-5-7-24-8-6-21/h3-4,10H,5-9H2,1-2H3,(H,17,22) |
| InChIKey | UYZZLFADMQITHE-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |