C18H23N5O4 — CID 121092010
3-methoxy-1-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]pyrazole-4-carboxamide (PubChem CID 121092010) has the molecular formula C18H23N5O4 and a molecular weight of 373.41 g/mol. Its IUPAC name is 3-methoxy-1-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]pyrazole-4-carboxamide.
| Compound Name | 3-methoxy-1-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121092010 |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 3-methoxy-1-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]pyrazole-4-carboxamide |
| SMILES | COc1nn(C)cc1C(=O)NCC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H23N5O4/c1-22-12-15(18(21-22)26-2)17(25)19-11-16(24)20-13-3-5-14(6-4-13)23-7-9-27-10-8-23/h3-6,12H,7-11H2,1-2H3,(H,19,25)(H,20,24) |
| InChIKey | FVGRIOJWIWYFQR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|