C15H15F3N4O3 — CID 121091888
3-methoxy-1-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pyrazole-4-carboxamide (PubChem CID 121091888) has the molecular formula C15H15F3N4O3 and a molecular weight of 356.30 g/mol. Its IUPAC name is 3-methoxy-1-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pyrazole-4-carboxamide.
| Compound Name | 3-methoxy-1-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121091888 |
| Molecular Formula | C15H15F3N4O3 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 3-methoxy-1-methyl-N-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]pyrazole-4-carboxamide |
| SMILES | COc1nn(C)cc1C(=O)NCC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H15F3N4O3/c1-22-8-9(14(21-22)25-2)13(24)19-7-12(23)20-11-6-4-3-5-10(11)15(16,17)18/h3-6,8H,7H2,1-2H3,(H,19,24)(H,20,23) |
| InChIKey | VIZSXXMOIFZCLY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |