C15H14ClN5O3 — CID 121091902
N-[2-(5-chloro-2-cyanoanilino)-2-oxoethyl]-3-methoxy-1-methylpyrazole-4-carboxamide (PubChem CID 121091902) has the molecular formula C15H14ClN5O3 and a molecular weight of 347.76 g/mol. Its IUPAC name is N-[2-(5-chloro-2-cyanoanilino)-2-oxoethyl]-3-methoxy-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[2-(5-chloro-2-cyanoanilino)-2-oxoethyl]-3-methoxy-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 121091902 |
| Molecular Formula | C15H14ClN5O3 |
| Molecular Weight | 347.76 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | N-[2-(5-chloro-2-cyanoanilino)-2-oxoethyl]-3-methoxy-1-methylpyrazole-4-carboxamide |
| SMILES | COc1nn(C)cc1C(=O)NCC(=O)Nc1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C15H14ClN5O3/c1-21-8-11(15(20-21)24-2)14(23)18-7-13(22)19-12-5-10(16)4-3-9(12)6-17/h3-5,8H,7H2,1-2H3,(H,18,23)(H,19,22) |
| InChIKey | IDNYIRRPZITPOS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.76 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |