C15H27N5O3S — CID 121075534
N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]butane-1-sulfonamide (PubChem CID 121075534) has the molecular formula C15H27N5O3S and a molecular weight of 357.48 g/mol. Its IUPAC name is N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]butane-1-sulfonamide.
| Compound Name | N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 121075534 |
| Molecular Formula | C15H27N5O3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCCNc1nc(C)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H27N5O3S/c1-3-4-11-24(21,22)17-6-5-16-15-18-13(2)12-14(19-15)20-7-9-23-10-8-20/h12,17H,3-11H2,1-2H3,(H,16,18,19) |
| InChIKey | XRLRZTSCETWMJL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|