C21H31N5O4S — CID 121075509
4-butoxy-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]benzenesulfonamide (PubChem CID 121075509) has the molecular formula C21H31N5O4S and a molecular weight of 449.58 g/mol. Its IUPAC name is 4-butoxy-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-butoxy-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121075509 |
| Molecular Formula | C21H31N5O4S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 4-butoxy-N-[2-[(4-methyl-6-morpholin-4-ylpyrimidin-2-yl)amino]ethyl]benzenesulfonamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)NCCNc2nc(C)cc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C21H31N5O4S/c1-3-4-13-30-18-5-7-19(8-6-18)31(27,28)23-10-9-22-21-24-17(2)16-20(25-21)26-11-14-29-15-12-26/h5-8,16,23H,3-4,9-15H2,1-2H3,(H,22,24,25) |
| InChIKey | RFEBYEMFPCAYTM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|