C17H11ClF3NO4 — CID 2458121
3-chloro-1-[(7-methoxy-2-oxochromen-4-yl)methyl]-5-(trifluoromethyl)pyridin-2-one (PubChem CID 2458121) has the molecular formula C17H11ClF3NO4 and a molecular weight of 385.73 g/mol. Its IUPAC name is 3-chloro-1-[(7-methoxy-2-oxochromen-4-yl)methyl]-5-(trifluoromethyl)pyridin-2-one.
| Compound Name | 3-chloro-1-[(7-methoxy-2-oxochromen-4-yl)methyl]-5-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 2458121 |
| Molecular Formula | C17H11ClF3NO4 |
| Molecular Weight | 385.73 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 3-chloro-1-[(7-methoxy-2-oxochromen-4-yl)methyl]-5-(trifluoromethyl)pyridin-2-one |
| SMILES | COc1ccc2c(Cn3cc(C(F)(F)F)cc(Cl)c3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C17H11ClF3NO4/c1-25-11-2-3-12-9(4-15(23)26-14(12)6-11)7-22-8-10(17(19,20)21)5-13(18)16(22)24/h2-6,8H,7H2,1H3 |
| InChIKey | JPFYAUZJLMRBOI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.73 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|