C16H10N4O3 — CID 75508734
1-[(7-methoxy-2-oxochromen-4-yl)methyl]imidazole-4,5-dicarbonitrile (PubChem CID 75508734) has the molecular formula C16H10N4O3 and a molecular weight of 306.28 g/mol. Its IUPAC name is 1-[(7-methoxy-2-oxochromen-4-yl)methyl]imidazole-4,5-dicarbonitrile.
| Compound Name | 1-[(7-methoxy-2-oxochromen-4-yl)methyl]imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 75508734 |
| Molecular Formula | C16H10N4O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 1-[(7-methoxy-2-oxochromen-4-yl)methyl]imidazole-4,5-dicarbonitrile |
| SMILES | COc1ccc2c(Cn3cnc(C#N)c3C#N)cc(=O)oc2c1 |
| InChI | InChI=1S/C16H10N4O3/c1-22-11-2-3-12-10(4-16(21)23-15(12)5-11)8-20-9-19-13(6-17)14(20)7-18/h2-5,9H,8H2,1H3 |
| InChIKey | RCBAIKBIAJQDFB-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 104.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|