C18H27F3N4O+2 — CID 9288514
N-cyclohexyl-2-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium-1-yl]acetamide (PubChem CID 9288514) has the molecular formula C18H27F3N4O+2 and a molecular weight of 372.44 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9288514 |
| Molecular Formula | C18H27F3N4O+2 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | N-cyclohexyl-2-[4-[5-(trifluoromethyl)pyridin-1-ium-2-yl]piperazin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCN(c2ccc(C(F)(F)F)c[nH+]2)CC1)NC1CCCCC1 |
| InChI | InChI=1S/C18H25F3N4O/c19-18(20,21)14-6-7-16(22-12-14)25-10-8-24(9-11-25)13-17(26)23-15-4-2-1-3-5-15/h6-7,12,15H,1-5,8-11,13H2,(H,23,26)/p+2 |
| InChIKey | CEQOTZDIHQUWRG-UHFFFAOYSA-P |
| XLogP | 0.67 |
| TPSA | 50.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |