C16H25N2OS+ — CID 8583796
2-(azocan-1-ium-1-yl)-N-(3-methylsulfanylphenyl)acetamide (PubChem CID 8583796) has the molecular formula C16H25N2OS+ and a molecular weight of 293.46 g/mol. Its IUPAC name is 2-(azocan-1-ium-1-yl)-N-(3-methylsulfanylphenyl)acetamide.
| Compound Name | 2-(azocan-1-ium-1-yl)-N-(3-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 8583796 |
| Molecular Formula | C16H25N2OS+ |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-(azocan-1-ium-1-yl)-N-(3-methylsulfanylphenyl)acetamide |
| SMILES | CSc1cccc(NC(=O)C[NH+]2CCCCCCC2)c1 |
| InChI | InChI=1S/C16H24N2OS/c1-20-15-9-7-8-14(12-15)17-16(19)13-18-10-5-3-2-4-6-11-18/h7-9,12H,2-6,10-11,13H2,1H3,(H,17,19)/p+1 |
| InChIKey | UDBGTCOSMZYEAO-UHFFFAOYSA-O |
| XLogP | 2.20 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |