C20H26N3O3S2+ — CID 9443698
2-(4-benzylsulfonylpiperazin-1-ium-1-yl)-N-(3-methylsulfanylphenyl)acetamide (PubChem CID 9443698) has the molecular formula C20H26N3O3S2+ and a molecular weight of 420.58 g/mol. Its IUPAC name is 2-(4-benzylsulfonylpiperazin-1-ium-1-yl)-N-(3-methylsulfanylphenyl)acetamide.
| Compound Name | 2-(4-benzylsulfonylpiperazin-1-ium-1-yl)-N-(3-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 9443698 |
| Molecular Formula | C20H26N3O3S2+ |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-(4-benzylsulfonylpiperazin-1-ium-1-yl)-N-(3-methylsulfanylphenyl)acetamide |
| SMILES | CSc1cccc(NC(=O)C[NH+]2CCN(S(=O)(=O)Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H25N3O3S2/c1-27-19-9-5-8-18(14-19)21-20(24)15-22-10-12-23(13-11-22)28(25,26)16-17-6-3-2-4-7-17/h2-9,14H,10-13,15-16H2,1H3,(H,21,24)/p+1 |
| InChIKey | SWYMTFNGUHJYPL-UHFFFAOYSA-O |
| XLogP | 1.08 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |