C21H26N3O4+ — CID 9223633
2-(4-benzoylpiperazin-1-ium-1-yl)-N-(2,4-dimethoxyphenyl)acetamide (PubChem CID 9223633) has the molecular formula C21H26N3O4+ and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-(4-benzoylpiperazin-1-ium-1-yl)-N-(2,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-(2,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9223633 |
| Molecular Formula | C21H26N3O4+ |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-(2,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)C[NH+]2CCN(C(=O)c3ccccc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C21H25N3O4/c1-27-17-8-9-18(19(14-17)28-2)22-20(25)15-23-10-12-24(13-11-23)21(26)16-6-4-3-5-7-16/h3-9,14H,10-13,15H2,1-2H3,(H,22,25)/p+1 |
| InChIKey | WZCFVSXPSKEQBQ-UHFFFAOYSA-O |
| XLogP | 0.68 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |