C23H30N3O4+ — CID 9223601
2-(4-benzoylpiperazin-1-ium-1-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide (PubChem CID 9223601) has the molecular formula C23H30N3O4+ and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-(4-benzoylpiperazin-1-ium-1-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 9223601 |
| Molecular Formula | C23H30N3O4+ |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)C[NH+]2CCN(C(=O)c3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C23H29N3O4/c1-29-20-9-8-18(16-21(20)30-2)10-11-24-22(27)17-25-12-14-26(15-13-25)23(28)19-6-4-3-5-7-19/h3-9,16H,10-15,17H2,1-2H3,(H,24,27)/p+1 |
| InChIKey | BENHJMLLRUYQHL-UHFFFAOYSA-O |
| XLogP | 0.40 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |