C21H27N3O3 — CID 34222283
N,N-diethyl-4-(2-naphthalen-2-yloxyacetyl)piperazine-1-carboxamide (PubChem CID 34222283) has the molecular formula C21H27N3O3 and a molecular weight of 369.46 g/mol. Its IUPAC name is N,N-diethyl-4-(2-naphthalen-2-yloxyacetyl)piperazine-1-carboxamide.
| Compound Name | N,N-diethyl-4-(2-naphthalen-2-yloxyacetyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 34222283 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N,N-diethyl-4-(2-naphthalen-2-yloxyacetyl)piperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(C(=O)COc2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C21H27N3O3/c1-3-22(4-2)21(26)24-13-11-23(12-14-24)20(25)16-27-19-10-9-17-7-5-6-8-18(17)15-19/h5-10,15H,3-4,11-14,16H2,1-2H3 |
| InChIKey | RVFDTZKKIDWWOJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |