C18H27N3O4 — CID 110365995
N,N-diethyl-4-[2-(4-methoxyphenoxy)acetyl]piperazine-1-carboxamide (PubChem CID 110365995) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is N,N-diethyl-4-[2-(4-methoxyphenoxy)acetyl]piperazine-1-carboxamide.
| Compound Name | N,N-diethyl-4-[2-(4-methoxyphenoxy)acetyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110365995 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | N,N-diethyl-4-[2-(4-methoxyphenoxy)acetyl]piperazine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCN(C(=O)COc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C18H27N3O4/c1-4-19(5-2)18(23)21-12-10-20(11-13-21)17(22)14-25-16-8-6-15(24-3)7-9-16/h6-9H,4-5,10-14H2,1-3H3 |
| InChIKey | KJZXGMADWZLAOE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |