C24H31N3O5 — CID 10238336
N-hydroxy-8-[4-(2-naphthalen-2-yloxyacetyl)piperazin-1-yl]-8-oxooctanamide (PubChem CID 10238336) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is N-hydroxy-8-[4-(2-naphthalen-2-yloxyacetyl)piperazin-1-yl]-8-oxooctanamide.
| Compound Name | N-hydroxy-8-[4-(2-naphthalen-2-yloxyacetyl)piperazin-1-yl]-8-oxooctanamide |
|---|---|
| PubChem CID | 10238336 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | N-hydroxy-8-[4-(2-naphthalen-2-yloxyacetyl)piperazin-1-yl]-8-oxooctanamide |
| SMILES | O=C(CCCCCCC(=O)N1CCN(C(=O)COc2ccc3ccccc3c2)CC1)NO |
| InChI | InChI=1S/C24H31N3O5/c28-22(25-31)9-3-1-2-4-10-23(29)26-13-15-27(16-14-26)24(30)18-32-21-12-11-19-7-5-6-8-20(19)17-21/h5-8,11-12,17,31H,1-4,9-10,13-16,18H2,(H,25,28) |
| InChIKey | KSFIMSZMTCGVGC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|