C10H12Cl2N2O2S — CID 71889820
2-(3,4-dichlorophenyl)pyrrolidine-1-sulfonamide (PubChem CID 71889820) has the molecular formula C10H12Cl2N2O2S and a molecular weight of 295.19 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)pyrrolidine-1-sulfonamide.
| Compound Name | 2-(3,4-dichlorophenyl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 71889820 |
| Molecular Formula | C10H12Cl2N2O2S |
| Molecular Weight | 295.19 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | 2-(3,4-dichlorophenyl)pyrrolidine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCCC1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H12Cl2N2O2S/c11-8-4-3-7(6-9(8)12)10-2-1-5-14(10)17(13,15)16/h3-4,6,10H,1-2,5H2,(H2,13,15,16) |
| InChIKey | YXBUPWFGYMBDDK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |