C12H16N2O4S — CID 154771448
2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-1-sulfonamide (PubChem CID 154771448) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-1-sulfonamide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 154771448 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCCC1c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H16N2O4S/c13-19(15,16)14-5-1-2-10(14)9-3-4-11-12(8-9)18-7-6-17-11/h3-4,8,10H,1-2,5-7H2,(H2,13,15,16) |
| InChIKey | SLCUVGAPHAAZDS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |