C9H14BrN5O3S — CID 106468175
N-[1-(5-bromo-3-methyltriazol-4-yl)sulfonylpyrrolidin-3-yl]acetamide (PubChem CID 106468175) has the molecular formula C9H14BrN5O3S and a molecular weight of 352.21 g/mol. Its IUPAC name is N-[1-(5-bromo-3-methyltriazol-4-yl)sulfonylpyrrolidin-3-yl]acetamide.
| Compound Name | N-[1-(5-bromo-3-methyltriazol-4-yl)sulfonylpyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 106468175 |
| Molecular Formula | C9H14BrN5O3S |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | N-[1-(5-bromo-3-methyltriazol-4-yl)sulfonylpyrrolidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCN(S(=O)(=O)c2c(Br)nnn2C)C1 |
| InChI | InChI=1S/C9H14BrN5O3S/c1-6(16)11-7-3-4-15(5-7)19(17,18)9-8(10)12-13-14(9)2/h7H,3-5H2,1-2H3,(H,11,16) |
| InChIKey | KAIRXXHPDNQGCG-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |