C14H19N3O2S2 — CID 96539033
(2S)-1-(5-ethylthiophen-2-yl)sulfonyl-2-(1H-imidazol-2-yl)piperidine (PubChem CID 96539033) has the molecular formula C14H19N3O2S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is (2S)-1-(5-ethylthiophen-2-yl)sulfonyl-2-(1H-imidazol-2-yl)piperidine.
| Compound Name | (2S)-1-(5-ethylthiophen-2-yl)sulfonyl-2-(1H-imidazol-2-yl)piperidine |
|---|---|
| PubChem CID | 96539033 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | (2S)-1-(5-ethylthiophen-2-yl)sulfonyl-2-(1H-imidazol-2-yl)piperidine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCCC[C@H]2c2ncc[nH]2)s1 |
| InChI | InChI=1S/C14H19N3O2S2/c1-2-11-6-7-13(20-11)21(18,19)17-10-4-3-5-12(17)14-15-8-9-16-14/h6-9,12H,2-5,10H2,1H3,(H,15,16)/t12-/m0/s1 |
| InChIKey | FWMQCRZXRFISLB-LBPRGKRZSA-N |
| XLogP | 2.95 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |