C14H15N5O2S2 — CID 119037593
4-[2-(1H-imidazol-2-yl)piperidin-1-yl]sulfonyl-2,1,3-benzothiadiazole (PubChem CID 119037593) has the molecular formula C14H15N5O2S2 and a molecular weight of 349.44 g/mol. Its IUPAC name is 4-[2-(1H-imidazol-2-yl)piperidin-1-yl]sulfonyl-2,1,3-benzothiadiazole.
| Compound Name | 4-[2-(1H-imidazol-2-yl)piperidin-1-yl]sulfonyl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 119037593 |
| Molecular Formula | C14H15N5O2S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 4-[2-(1H-imidazol-2-yl)piperidin-1-yl]sulfonyl-2,1,3-benzothiadiazole |
| SMILES | O=S(=O)(c1cccc2nsnc12)N1CCCCC1c1ncc[nH]1 |
| InChI | InChI=1S/C14H15N5O2S2/c20-23(21,12-6-3-4-10-13(12)18-22-17-10)19-9-2-1-5-11(19)14-15-7-8-16-14/h3-4,6-8,11H,1-2,5,9H2,(H,15,16) |
| InChIKey | PNSGKLOGIZDCRS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |