About 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-3-methylpiperazin-2-one
4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-3-methylpiperazin-2-one (PubChem CID 63362936) has the molecular formula C11H12N4O3S2
and a molecular weight of 312.38 g/mol. Its IUPAC name is 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-3-methylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-3-methylpiperazin-2-one |
| PubChem CID | 63362936 |
| Molecular Formula | C11H12N4O3S2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-3-methylpiperazin-2-one |
| SMILES | CC1C(=O)NCCN1S(=O)(=O)c1cccc2nsnc12 |
| InChI | InChI=1S/C11H12N4O3S2/c1-7-11(16)12-5-6-15(7)20(17,18)9-4-2-3-8-10(9)14-19-13-8/h2-4,7H,5-6H2,1H3,(H,12,16) |
| InChIKey | HPEPGATTWIEFFP-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-3-methylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-3-methylpiperazin-2-one?
The IUPAC name of 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-3-methylpiperazin-2-one (CID 63362936) is 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-3-methylpiperazin-2-one.
What is the SMILES notation for 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-3-methylpiperazin-2-one?
The canonical SMILES for 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-3-methylpiperazin-2-one is CC1C(=O)NCCN1S(=O)(=O)c1cccc2nsnc12.
What is the InChIKey of 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-3-methylpiperazin-2-one?
The InChIKey is HPEPGATTWIEFFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O3S2/c1-7-11(16)12-5-6-15(7)20(17,18)9-4-2-3-8-10(9)14-19-13-8/h2-4,7H,5-6H2,1H3,(H,12,16).
What are the key properties of 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-3-methylpiperazin-2-one?
4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-3-methylpiperazin-2-one has a molecular weight of 312.38 g/mol, XLogP of 0.20, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,1,3-benzothiadiazol-4-ylsulfonyl)-3-methylpiperazin-2-one is sourced from PubChem (CID 63362936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).