C15H17NO5S3 — CID 175606970
[1-(3-thiophen-2-ylsulfonylphenyl)sulfonylpyrrolidin-2-yl]methanol (PubChem CID 175606970) has the molecular formula C15H17NO5S3 and a molecular weight of 387.50 g/mol. Its IUPAC name is [1-(3-thiophen-2-ylsulfonylphenyl)sulfonylpyrrolidin-2-yl]methanol.
| Compound Name | [1-(3-thiophen-2-ylsulfonylphenyl)sulfonylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 175606970 |
| Molecular Formula | C15H17NO5S3 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.03 |
| IUPAC Name | [1-(3-thiophen-2-ylsulfonylphenyl)sulfonylpyrrolidin-2-yl]methanol |
| SMILES | O=S(=O)(c1cccc(S(=O)(=O)N2CCCC2CO)c1)c1cccs1 |
| InChI | InChI=1S/C15H17NO5S3/c17-11-12-4-2-8-16(12)24(20,21)14-6-1-5-13(10-14)23(18,19)15-7-3-9-22-15/h1,3,5-7,9-10,12,17H,2,4,8,11H2 |
| InChIKey | PDSQELUFOMCMNZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |