C22H23NO5S3 — CID 150243178
(2S)-2-(phenylmethoxymethyl)-1-(3-thiophen-2-ylsulfonylphenyl)sulfonylpyrrolidine (PubChem CID 150243178) has the molecular formula C22H23NO5S3 and a molecular weight of 477.63 g/mol. Its IUPAC name is (2S)-2-(phenylmethoxymethyl)-1-(3-thiophen-2-ylsulfonylphenyl)sulfonylpyrrolidine.
| Compound Name | (2S)-2-(phenylmethoxymethyl)-1-(3-thiophen-2-ylsulfonylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 150243178 |
| Molecular Formula | C22H23NO5S3 |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | (2S)-2-(phenylmethoxymethyl)-1-(3-thiophen-2-ylsulfonylphenyl)sulfonylpyrrolidine |
| SMILES | O=S(=O)(c1cccc(S(=O)(=O)N2CCC[C@H]2COCc2ccccc2)c1)c1cccs1 |
| InChI | InChI=1S/C22H23NO5S3/c24-30(25,22-12-6-14-29-22)20-10-4-11-21(15-20)31(26,27)23-13-5-9-19(23)17-28-16-18-7-2-1-3-8-18/h1-4,6-8,10-12,14-15,19H,5,9,13,16-17H2/t19-/m0/s1 |
| InChIKey | FXYLGDQCWYZWIX-IBGZPJMESA-N |
| XLogP | 3.95 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |