C16H20N2O3S2 — CID 70655680
(3R)-3-(phenylmethoxymethyl)-1-thiophen-2-ylsulfonylpiperazine (PubChem CID 70655680) has the molecular formula C16H20N2O3S2 and a molecular weight of 352.48 g/mol. Its IUPAC name is (3R)-3-(phenylmethoxymethyl)-1-thiophen-2-ylsulfonylpiperazine.
| Compound Name | (3R)-3-(phenylmethoxymethyl)-1-thiophen-2-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 70655680 |
| Molecular Formula | C16H20N2O3S2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (3R)-3-(phenylmethoxymethyl)-1-thiophen-2-ylsulfonylpiperazine |
| SMILES | O=S(=O)(c1cccs1)N1CCN[C@@H](COCc2ccccc2)C1 |
| InChI | InChI=1S/C16H20N2O3S2/c19-23(20,16-7-4-10-22-16)18-9-8-17-15(11-18)13-21-12-14-5-2-1-3-6-14/h1-7,10,15,17H,8-9,11-13H2/t15-/m1/s1 |
| InChIKey | LHBQIEUARSLHLY-OAHLLOKOSA-N |
| XLogP | 1.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |