C14H23ClN2O3S2 — CID 70655430
3-(oxan-4-ylmethyl)-1-thiophen-2-ylsulfonylpiperazine;hydrochloride (PubChem CID 70655430) has the molecular formula C14H23ClN2O3S2 and a molecular weight of 366.94 g/mol. Its IUPAC name is 3-(oxan-4-ylmethyl)-1-thiophen-2-ylsulfonylpiperazine;hydrochloride.
| Compound Name | 3-(oxan-4-ylmethyl)-1-thiophen-2-ylsulfonylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 70655430 |
| Molecular Formula | C14H23ClN2O3S2 |
| Molecular Weight | 366.94 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 3-(oxan-4-ylmethyl)-1-thiophen-2-ylsulfonylpiperazine;hydrochloride |
| SMILES | Cl.O=S(=O)(c1cccs1)N1CCNC(CC2CCOCC2)C1 |
| InChI | InChI=1S/C14H22N2O3S2.ClH/c17-21(18,14-2-1-9-20-14)16-6-5-15-13(11-16)10-12-3-7-19-8-4-12;/h1-2,9,12-13,15H,3-8,10-11H2;1H |
| InChIKey | XMCZSXYIIFPVTH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.94 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |