C11H15N5OS2 — CID 78927799
3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(5-methyl-1H-1,2,4-triazol-3-yl)propanamide (PubChem CID 78927799) has the molecular formula C11H15N5OS2 and a molecular weight of 297.41 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(5-methyl-1H-1,2,4-triazol-3-yl)propanamide.
| Compound Name | 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(5-methyl-1H-1,2,4-triazol-3-yl)propanamide |
|---|---|
| PubChem CID | 78927799 |
| Molecular Formula | C11H15N5OS2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-(5-methyl-1H-1,2,4-triazol-3-yl)propanamide |
| SMILES | Cc1nc(NC(=O)CCSCc2csc(C)n2)n[nH]1 |
| InChI | InChI=1S/C11H15N5OS2/c1-7-12-11(16-15-7)14-10(17)3-4-18-5-9-6-19-8(2)13-9/h6H,3-5H2,1-2H3,(H2,12,14,15,16,17) |
| InChIKey | AVIQFEUMDZNWJA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|