C11H12F3N5OS2 — CID 47074392
3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]propanamide (PubChem CID 47074392) has the molecular formula C11H12F3N5OS2 and a molecular weight of 351.38 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]propanamide.
| Compound Name | 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]propanamide |
|---|---|
| PubChem CID | 47074392 |
| Molecular Formula | C11H12F3N5OS2 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]propanamide |
| SMILES | Cc1nc(CSCCC(=O)Nc2n[nH]c(C(F)(F)F)n2)cs1 |
| InChI | InChI=1S/C11H12F3N5OS2/c1-6-15-7(5-22-6)4-21-3-2-8(20)16-10-17-9(18-19-10)11(12,13)14/h5H,2-4H2,1H3,(H2,16,17,18,19,20) |
| InChIKey | RIVZGOQYKOFRJI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|