C13H20N2O3S2 — CID 79793366
2-methyl-2-[3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanoylamino]butanoic acid (PubChem CID 79793366) has the molecular formula C13H20N2O3S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 2-methyl-2-[3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanoylamino]butanoic acid.
| Compound Name | 2-methyl-2-[3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 79793366 |
| Molecular Formula | C13H20N2O3S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2-methyl-2-[3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanoylamino]butanoic acid |
| SMILES | CCC(C)(NC(=O)CCSCc1csc(C)n1)C(=O)O |
| InChI | InChI=1S/C13H20N2O3S2/c1-4-13(3,12(17)18)15-11(16)5-6-19-7-10-8-20-9(2)14-10/h8H,4-7H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | OLNRUSSSJPMFGT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|