C14H22N2O3S2 — CID 107144606
(2S)-2-[3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanoylamino]hexanoic acid (PubChem CID 107144606) has the molecular formula C14H22N2O3S2 and a molecular weight of 330.48 g/mol. Its IUPAC name is (2S)-2-[3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanoylamino]hexanoic acid.
| Compound Name | (2S)-2-[3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 107144606 |
| Molecular Formula | C14H22N2O3S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (2S)-2-[3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanoylamino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)CCSCc1csc(C)n1)C(=O)O |
| InChI | InChI=1S/C14H22N2O3S2/c1-3-4-5-12(14(18)19)16-13(17)6-7-20-8-11-9-21-10(2)15-11/h9,12H,3-8H2,1-2H3,(H,16,17)(H,18,19)/t12-/m0/s1 |
| InChIKey | GNSVZQQDXGXTFC-LBPRGKRZSA-N |
| XLogP | 2.83 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|