C16H28N2OS2 — CID 94069818
N-[(2S)-6-methylheptan-2-yl]-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide (PubChem CID 94069818) has the molecular formula C16H28N2OS2 and a molecular weight of 328.55 g/mol. Its IUPAC name is N-[(2S)-6-methylheptan-2-yl]-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide.
| Compound Name | N-[(2S)-6-methylheptan-2-yl]-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 94069818 |
| Molecular Formula | C16H28N2OS2 |
| Molecular Weight | 328.55 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-[(2S)-6-methylheptan-2-yl]-3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanamide |
| SMILES | Cc1nc(CSCCC(=O)N[C@@H](C)CCCC(C)C)cs1 |
| InChI | InChI=1S/C16H28N2OS2/c1-12(2)6-5-7-13(3)17-16(19)8-9-20-10-15-11-21-14(4)18-15/h11-13H,5-10H2,1-4H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | KJEVOTAKYPODEL-ZDUSSCGKSA-N |
| XLogP | 4.41 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|