C20H25NOS — CID 132651265
3-benzylsulfanyl-N-[1-(3,4-dimethylphenyl)ethyl]propanamide (PubChem CID 132651265) has the molecular formula C20H25NOS and a molecular weight of 327.49 g/mol. Its IUPAC name is 3-benzylsulfanyl-N-[1-(3,4-dimethylphenyl)ethyl]propanamide.
| Compound Name | 3-benzylsulfanyl-N-[1-(3,4-dimethylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 132651265 |
| Molecular Formula | C20H25NOS |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 3-benzylsulfanyl-N-[1-(3,4-dimethylphenyl)ethyl]propanamide |
| SMILES | Cc1ccc(C(C)NC(=O)CCSCc2ccccc2)cc1C |
| InChI | InChI=1S/C20H25NOS/c1-15-9-10-19(13-16(15)2)17(3)21-20(22)11-12-23-14-18-7-5-4-6-8-18/h4-10,13,17H,11-12,14H2,1-3H3,(H,21,22) |
| InChIKey | NYLZFFQJOKKQFM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|