C16H16N2O3S — CID 27990293
3-(2-oxo-1,3-benzoxazol-3-yl)-N-[(1R)-1-thiophen-2-ylethyl]propanamide (PubChem CID 27990293) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is 3-(2-oxo-1,3-benzoxazol-3-yl)-N-[(1R)-1-thiophen-2-ylethyl]propanamide.
| Compound Name | 3-(2-oxo-1,3-benzoxazol-3-yl)-N-[(1R)-1-thiophen-2-ylethyl]propanamide |
|---|---|
| PubChem CID | 27990293 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 3-(2-oxo-1,3-benzoxazol-3-yl)-N-[(1R)-1-thiophen-2-ylethyl]propanamide |
| SMILES | C[C@@H](NC(=O)CCn1c(=O)oc2ccccc21)c1cccs1 |
| InChI | InChI=1S/C16H16N2O3S/c1-11(14-7-4-10-22-14)17-15(19)8-9-18-12-5-2-3-6-13(12)21-16(18)20/h2-7,10-11H,8-9H2,1H3,(H,17,19)/t11-/m1/s1 |
| InChIKey | GRYUVSQKMIAECT-LLVKDONJSA-N |
| XLogP | 2.92 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |