C21H18N2O3S — CID 24682652
3-(2-oxo-1,3-benzoxazol-3-yl)-N-[phenyl(thiophen-2-yl)methyl]propanamide (PubChem CID 24682652) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is 3-(2-oxo-1,3-benzoxazol-3-yl)-N-[phenyl(thiophen-2-yl)methyl]propanamide.
| Compound Name | 3-(2-oxo-1,3-benzoxazol-3-yl)-N-[phenyl(thiophen-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 24682652 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 3-(2-oxo-1,3-benzoxazol-3-yl)-N-[phenyl(thiophen-2-yl)methyl]propanamide |
| SMILES | O=C(CCn1c(=O)oc2ccccc21)NC(c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C21H18N2O3S/c24-19(12-13-23-16-9-4-5-10-17(16)26-21(23)25)22-20(18-11-6-14-27-18)15-7-2-1-3-8-15/h1-11,14,20H,12-13H2,(H,22,24) |
| InChIKey | CWXXEUWQAWBDMH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |