C18H27NO2 — CID 100553248
(2R)-N-pentyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanamide (PubChem CID 100553248) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (2R)-N-pentyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanamide.
| Compound Name | (2R)-N-pentyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanamide |
|---|---|
| PubChem CID | 100553248 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (2R)-N-pentyl-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanamide |
| SMILES | CCCCCNC(=O)[C@@H](C)Oc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C18H27NO2/c1-3-4-7-12-19-18(20)14(2)21-17-11-10-15-8-5-6-9-16(15)13-17/h10-11,13-14H,3-9,12H2,1-2H3,(H,19,20)/t14-/m1/s1 |
| InChIKey | JPOMOIODSVKESN-CQSZACIVSA-N |
| XLogP | 3.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|