C22H26ClNO2 — CID 133200044
N-[3-(4-chlorophenyl)propyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanamide (PubChem CID 133200044) has the molecular formula C22H26ClNO2 and a molecular weight of 371.91 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)propyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanamide.
| Compound Name | N-[3-(4-chlorophenyl)propyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanamide |
|---|---|
| PubChem CID | 133200044 |
| Molecular Formula | C22H26ClNO2 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-[3-(4-chlorophenyl)propyl]-2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propanamide |
| SMILES | CC(Oc1ccc2c(c1)CCCC2)C(=O)NCCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H26ClNO2/c1-16(26-21-13-10-18-6-2-3-7-19(18)15-21)22(25)24-14-4-5-17-8-11-20(23)12-9-17/h8-13,15-16H,2-7,14H2,1H3,(H,24,25) |
| InChIKey | ZKKUIFLTAJBMMC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|