C23H29N2O2+ — CID 19003130
[1-[(3,5-dimethylphenyl)methoxy]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-trimethylazanium (PubChem CID 19003130) has the molecular formula C23H29N2O2+ and a molecular weight of 365.50 g/mol. Its IUPAC name is [1-[(3,5-dimethylphenyl)methoxy]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-trimethylazanium.
| Compound Name | [1-[(3,5-dimethylphenyl)methoxy]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 19003130 |
| Molecular Formula | C23H29N2O2+ |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | [1-[(3,5-dimethylphenyl)methoxy]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]-trimethylazanium |
| SMILES | Cc1cc(C)cc(COC(=O)C(Cc2c[nH]c3ccccc23)[N+](C)(C)C)c1 |
| InChI | InChI=1S/C23H29N2O2/c1-16-10-17(2)12-18(11-16)15-27-23(26)22(25(3,4)5)13-19-14-24-21-9-7-6-8-20(19)21/h6-12,14,22,24H,13,15H2,1-5H3/q+1 |
| InChIKey | QEQMAEXQVGXASS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|