C19H22N2 — CID 83977083
2-(3,5-dimethylphenyl)-3-(1H-indol-3-yl)propan-1-amine (PubChem CID 83977083) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-3-(1H-indol-3-yl)propan-1-amine.
| Compound Name | 2-(3,5-dimethylphenyl)-3-(1H-indol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 83977083 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-3-(1H-indol-3-yl)propan-1-amine |
| SMILES | Cc1cc(C)cc(C(CN)Cc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C19H22N2/c1-13-7-14(2)9-15(8-13)16(11-20)10-17-12-21-19-6-4-3-5-18(17)19/h3-9,12,16,21H,10-11,20H2,1-2H3 |
| InChIKey | RIWKICUJKLHMEG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |