C21H34N4O12 — CID 24970026
[(3S,4R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptanoate (PubChem CID 24970026) has the molecular formula C21H34N4O12 and a molecular weight of 534.52 g/mol. Its IUPAC name is [(3S,4R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptanoate.
| Compound Name | [(3S,4R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptanoate |
|---|---|
| PubChem CID | 24970026 |
| Molecular Formula | C21H34N4O12 |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | [(3S,4R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl 7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptanoate |
| SMILES | NC(=O)c1ncn(C2OC(COC(=O)CCCCCCOC3OC(CO)C(O)C(O)C3O)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C21H34N4O12/c22-18(33)19-23-9-25(24-19)20-16(31)14(29)11(36-20)8-35-12(27)5-3-1-2-4-6-34-21-17(32)15(30)13(28)10(7-26)37-21/h9-11,13-17,20-21,26,28-32H,1-8H2,(H2,22,33)/t10?,11?,13?,14-,15?,16-,17?,20?,21?/m1/s1 |
| InChIKey | UEZYLFJGTULANM-LBMSEGHHSA-N |
| XLogP | -3.69 |
| TPSA | 249.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|