C16H19N5O7 — CID 173484429
N-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboximidoyl]-2-methylperoxybenzamide (PubChem CID 173484429) has the molecular formula C16H19N5O7 and a molecular weight of 393.36 g/mol. Its IUPAC name is N-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboximidoyl]-2-methylperoxybenzamide.
| Compound Name | N-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboximidoyl]-2-methylperoxybenzamide |
|---|---|
| PubChem CID | 173484429 |
| Molecular Formula | C16H19N5O7 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | N-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboximidoyl]-2-methylperoxybenzamide |
| SMILES | [H]/N=C(/NC(=O)c1ccccc1OOC)c1ncn(C2OC(CO)C(O)C2O)n1 |
| InChI | InChI=1S/C16H19N5O7/c1-26-28-9-5-3-2-4-8(9)15(25)19-13(17)14-18-7-21(20-14)16-12(24)11(23)10(6-22)27-16/h2-5,7,10-12,16,22-24H,6H2,1H3,(H2,17,19,25) |
| InChIKey | NLZOAWHXECIHNS-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 172.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|