C15H21N4O14P3 — CID 101080501
[[(2R,3S,4R,5R)-5-[3-(benzylcarbamoyl)-1,2,4-triazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 101080501) has the molecular formula C15H21N4O14P3 and a molecular weight of 574.27 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[3-(benzylcarbamoyl)-1,2,4-triazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-[3-(benzylcarbamoyl)-1,2,4-triazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 101080501 |
| Molecular Formula | C15H21N4O14P3 |
| Molecular Weight | 574.27 g/mol |
| Exact Mass | 574.03 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[3-(benzylcarbamoyl)-1,2,4-triazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=C(NCc1ccccc1)c1ncn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C15H21N4O14P3/c20-11-10(7-30-35(26,27)33-36(28,29)32-34(23,24)25)31-15(12(11)21)19-8-17-13(18-19)14(22)16-6-9-4-2-1-3-5-9/h1-5,8,10-12,15,20-21H,6-7H2,(H,16,22)(H,26,27)(H,28,29)(H2,23,24,25)/t10-,11-,12-,15-/m1/s1 |
| InChIKey | XQWZFBHUBIPJML-RTWAVKEYSA-N |
| XLogP | -0.83 |
| TPSA | 269.32 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.27 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|