C17H20N3O14P3 — CID 24754990
[[(2R,3S,4R,5R)-5-[3-carbamoyl-4-(2-phenylethynyl)pyrazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 24754990) has the molecular formula C17H20N3O14P3 and a molecular weight of 583.28 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[3-carbamoyl-4-(2-phenylethynyl)pyrazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-[3-carbamoyl-4-(2-phenylethynyl)pyrazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 24754990 |
| Molecular Formula | C17H20N3O14P3 |
| Molecular Weight | 583.28 g/mol |
| Exact Mass | 583.02 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[3-carbamoyl-4-(2-phenylethynyl)pyrazol-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NC(=O)c1nn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)cc1C#Cc1ccccc1 |
| InChI | InChI=1S/C17H20N3O14P3/c18-16(23)13-11(7-6-10-4-2-1-3-5-10)8-20(19-13)17-15(22)14(21)12(32-17)9-31-36(27,28)34-37(29,30)33-35(24,25)26/h1-5,8,12,14-15,17,21-22H,9H2,(H2,18,23)(H,27,28)(H,29,30)(H2,24,25,26)/t12-,14-,15-,17-/m1/s1 |
| InChIKey | MADUSWVJGXDFAO-DNNBLBMLSA-N |
| XLogP | -0.66 |
| TPSA | 270.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.28 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|