C9H15FN3O14P3 — CID 10767737
[[(2R,3S,4R,5R)-5-(3-carbamoyl-4-fluoropyrazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 10767737) has the molecular formula C9H15FN3O14P3 and a molecular weight of 501.15 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(3-carbamoyl-4-fluoropyrazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(3-carbamoyl-4-fluoropyrazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 10767737 |
| Molecular Formula | C9H15FN3O14P3 |
| Molecular Weight | 501.15 g/mol |
| Exact Mass | 500.98 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(3-carbamoyl-4-fluoropyrazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NC(=O)c1nn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]2O)cc1F |
| InChI | InChI=1S/C9H15FN3O14P3/c10-3-1-13(12-5(3)8(11)16)9-7(15)6(14)4(25-9)2-24-29(20,21)27-30(22,23)26-28(17,18)19/h1,4,6-7,9,14-15H,2H2,(H2,11,16)(H,20,21)(H,22,23)(H2,17,18,19)/t4-,6-,7-,9-/m1/s1 |
| InChIKey | BZUNZGBPANOWED-FJGDRVTGSA-N |
| XLogP | -1.92 |
| TPSA | 270.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.15 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|