C16H27N4O7P — CID 162481943
1-[(3R,4S,5R)-5-[(E)-2-di(propan-2-yloxy)phosphorylprop-1-enyl]-3,4-dihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 162481943) has the molecular formula C16H27N4O7P and a molecular weight of 418.39 g/mol. Its IUPAC name is 1-[(3R,4S,5R)-5-[(E)-2-di(propan-2-yloxy)phosphorylprop-1-enyl]-3,4-dihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[(3R,4S,5R)-5-[(E)-2-di(propan-2-yloxy)phosphorylprop-1-enyl]-3,4-dihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 162481943 |
| Molecular Formula | C16H27N4O7P |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 1-[(3R,4S,5R)-5-[(E)-2-di(propan-2-yloxy)phosphorylprop-1-enyl]-3,4-dihydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | C/C(=C\[C@H]1OC(n2cnc(C(N)=O)n2)[C@H](O)[C@@H]1O)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C16H27N4O7P/c1-8(2)26-28(24,27-9(3)4)10(5)6-11-12(21)13(22)16(25-11)20-7-18-15(19-20)14(17)23/h6-9,11-13,16,21-22H,1-5H3,(H2,17,23)/b10-6+/t11-,12-,13-,16?/m1/s1 |
| InChIKey | OMGSCZRNUQAUEU-ZBAZHTCBSA-N |
| XLogP | 0.94 |
| TPSA | 159.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|