C15H17N4O8P — CID 162481964
[(E)-2-[(2R,3S,4R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl]-(2-hydroxyphenoxy)phosphinic acid (PubChem CID 162481964) has the molecular formula C15H17N4O8P and a molecular weight of 412.30 g/mol. Its IUPAC name is [(E)-2-[(2R,3S,4R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl]-(2-hydroxyphenoxy)phosphinic acid.
| Compound Name | [(E)-2-[(2R,3S,4R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl]-(2-hydroxyphenoxy)phosphinic acid |
|---|---|
| PubChem CID | 162481964 |
| Molecular Formula | C15H17N4O8P |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | [(E)-2-[(2R,3S,4R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-3,4-dihydroxyoxolan-2-yl]ethenyl]-(2-hydroxyphenoxy)phosphinic acid |
| SMILES | NC(=O)c1ncn(C2O[C@H](/C=C/P(=O)(O)Oc3ccccc3O)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C15H17N4O8P/c16-13(23)14-17-7-19(18-14)15-12(22)11(21)10(26-15)5-6-28(24,25)27-9-4-2-1-3-8(9)20/h1-7,10-12,15,20-22H,(H2,16,23)(H,24,25)/b6-5+/t10-,11-,12-,15?/m1/s1 |
| InChIKey | ACLVMXXFZZYFKU-YWPPBJFASA-N |
| XLogP | -0.52 |
| TPSA | 190.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|