C8H13N4O7P — CID 25007157
[(2R,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-4-hydroxyoxolan-2-yl]oxymethylphosphonic acid (PubChem CID 25007157) has the molecular formula C8H13N4O7P and a molecular weight of 308.19 g/mol. Its IUPAC name is [(2R,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-4-hydroxyoxolan-2-yl]oxymethylphosphonic acid.
| Compound Name | [(2R,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-4-hydroxyoxolan-2-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 25007157 |
| Molecular Formula | C8H13N4O7P |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | [(2R,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-4-hydroxyoxolan-2-yl]oxymethylphosphonic acid |
| SMILES | NC(=O)c1ncn([C@@H]2O[C@H](OCP(=O)(O)O)C[C@H]2O)n1 |
| InChI | InChI=1S/C8H13N4O7P/c9-6(14)7-10-2-12(11-7)8-4(13)1-5(19-8)18-3-20(15,16)17/h2,4-5,8,13H,1,3H2,(H2,9,14)(H2,15,16,17)/t4-,5+,8-/m1/s1 |
| InChIKey | MYDFCNCVTHUZOI-GLDDHUGJSA-N |
| XLogP | -1.87 |
| TPSA | 170.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|