C10H15N4O6P — CID 146511237
[(2S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-4-hydroxyoxolan-2-yl]methoxy-ethenylphosphinic acid (PubChem CID 146511237) has the molecular formula C10H15N4O6P and a molecular weight of 318.23 g/mol. Its IUPAC name is [(2S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-4-hydroxyoxolan-2-yl]methoxy-ethenylphosphinic acid.
| Compound Name | [(2S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-4-hydroxyoxolan-2-yl]methoxy-ethenylphosphinic acid |
|---|---|
| PubChem CID | 146511237 |
| Molecular Formula | C10H15N4O6P |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | [(2S,4R,5R)-5-(3-carbamoyl-1,2,4-triazol-1-yl)-4-hydroxyoxolan-2-yl]methoxy-ethenylphosphinic acid |
| SMILES | C=CP(=O)(O)OC[C@@H]1C[C@@H](O)[C@H](n2cnc(C(N)=O)n2)O1 |
| InChI | InChI=1S/C10H15N4O6P/c1-2-21(17,18)19-4-6-3-7(15)10(20-6)14-5-12-9(13-14)8(11)16/h2,5-7,10,15H,1,3-4H2,(H2,11,16)(H,17,18)/t6-,7+,10+/m0/s1 |
| InChIKey | FBQGHMCFIHQCKB-NYNCVSEMSA-N |
| XLogP | -0.63 |
| TPSA | 149.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|