C13H21F2N4O6P — CID 146511071
1-[(2R,3R,5S)-5-(2-diethoxyphosphoryl-2,2-difluoroethyl)-3-hydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 146511071) has the molecular formula C13H21F2N4O6P and a molecular weight of 398.30 g/mol. Its IUPAC name is 1-[(2R,3R,5S)-5-(2-diethoxyphosphoryl-2,2-difluoroethyl)-3-hydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[(2R,3R,5S)-5-(2-diethoxyphosphoryl-2,2-difluoroethyl)-3-hydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 146511071 |
| Molecular Formula | C13H21F2N4O6P |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 1-[(2R,3R,5S)-5-(2-diethoxyphosphoryl-2,2-difluoroethyl)-3-hydroxyoxolan-2-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | CCOP(=O)(OCC)C(F)(F)C[C@@H]1C[C@@H](O)[C@H](n2cnc(C(N)=O)n2)O1 |
| InChI | InChI=1S/C13H21F2N4O6P/c1-3-23-26(22,24-4-2)13(14,15)6-8-5-9(20)12(25-8)19-7-17-11(18-19)10(16)21/h7-9,12,20H,3-6H2,1-2H3,(H2,16,21)/t8-,9+,12+/m0/s1 |
| InChIKey | XFCTZYZUUMKLPW-YGOYTEALSA-N |
| XLogP | 1.27 |
| TPSA | 138.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|