C15H24F2N3O7P — CID 163458882
(2R,3R,4S,5R)-2-[4-(1-aminoethenyl)-5-hydroxyimidazol-1-yl]-5-(2-diethoxyphosphoryl-2,2-difluoroethyl)oxolane-3,4-diol (PubChem CID 163458882) has the molecular formula C15H24F2N3O7P and a molecular weight of 427.34 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[4-(1-aminoethenyl)-5-hydroxyimidazol-1-yl]-5-(2-diethoxyphosphoryl-2,2-difluoroethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[4-(1-aminoethenyl)-5-hydroxyimidazol-1-yl]-5-(2-diethoxyphosphoryl-2,2-difluoroethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 163458882 |
| Molecular Formula | C15H24F2N3O7P |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | (2R,3R,4S,5R)-2-[4-(1-aminoethenyl)-5-hydroxyimidazol-1-yl]-5-(2-diethoxyphosphoryl-2,2-difluoroethyl)oxolane-3,4-diol |
| SMILES | C=C(N)c1ncn([C@@H]2O[C@H](CC(F)(F)P(=O)(OCC)OCC)[C@@H](O)[C@H]2O)c1O |
| InChI | InChI=1S/C15H24F2N3O7P/c1-4-25-28(24,26-5-2)15(16,17)6-9-11(21)12(22)14(27-9)20-7-19-10(8(3)18)13(20)23/h7,9,11-12,14,21-23H,3-6,18H2,1-2H3/t9-,11-,12-,14-/m1/s1 |
| InChIKey | OCSFFENCRGIMMT-XIDUGBJDSA-N |
| XLogP | 1.39 |
| TPSA | 149.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|