C11H18N3O9P — CID 23271569
ethyl 5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]imidazole-4-carboxylate (PubChem CID 23271569) has the molecular formula C11H18N3O9P and a molecular weight of 367.25 g/mol. Its IUPAC name is ethyl 5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]imidazole-4-carboxylate.
| Compound Name | ethyl 5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 23271569 |
| Molecular Formula | C11H18N3O9P |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | ethyl 5-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(phosphonooxymethyl)oxolan-2-yl]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncn([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c1N |
| InChI | InChI=1S/C11H18N3O9P/c1-2-21-11(17)6-9(12)14(4-13-6)10-8(16)7(15)5(23-10)3-22-24(18,19)20/h4-5,7-8,10,15-16H,2-3,12H2,1H3,(H2,18,19,20)/t5-,7-,8-,10-/m1/s1 |
| InChIKey | HSSVJDZZBTXQRM-VPCXQMTMSA-N |
| XLogP | -1.63 |
| TPSA | 186.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|